Cinitapride-[d5]
Cinitapride-[d5], is the labelled analogue of Cinitapride. Cinitapride is a gastroprokinetic agent and antiemetic agent of the benzamide class. It acts as an agonist of the 5-HT1 and 5-HT4 receptors and as an antagonist of the 5-HT2 receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003498 |
| Pricing | Inquire |
| Cas | 2714421-62-0 |
| Molecular Weight | 407.53 |
| Molecular Formula | C21H25D5N4O4 |
| Canonical SMILES | CCOC1=CC(=C(C=C1C(=O)NC2CCN(CC2)CC3CCC=CC3)[N+](=O)[O-])N |