2,3,4,6-Tetra-O-benzoyl-b-D-galactopyranosyl cyanide
2,3,4,6-Tetra-O-benzoyl-b-D-galactopyranosyl cyanide, a chemical compound widely employed in the biomedical sector for synthetic procedures, represents a fascinating reagent for biomolecular research. Its employment allows for the synthesis of diverse glycosylated compounds, providing unparalleled insights into the intricate mechanisms governing glycosylation within cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 128095-47-6 |
| Pricing | Inquire |
| Cas | 128095-47-6 |
| Molecular Weight | 605.6 |
| Molecular Formula | C35H27NO9 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)C#N)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |