(Lys22)-Amyloid β-Protein (1-40)
(Lys22)-Amyloid β-Protein (1-40) is an Italian mutation of β-amyloid 1-40 (E22K), which aggregates faster than wild-type sequence 1-40. It exhibits higher neurotoxicity, probably due to the salt bridge formed between Lys22 and Asp23 in the minor conformer. Like the Arctic, Flemish and Dutch mutants, it is degraded by neprilysin much more slowly than the wild-type Aβ.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015346 |
| Pricing | Inquire |
| Cas | 302905-01-7 |
| Molecular Weight | 4328.92 |
| Molecular Formula | C195H300N54O56S |
| Canonical SMILES | CCC(C)C(C(=O)NC(C(C)CC)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCSC)C(=O)NC(C(C)C)C(=O)NCC(=O)NCC(=O)NC(C(C)C)C(=O)NC(C(C)C)C(=O)O)NC(=O)C(C)NC(=O)CNC(=O)C(CCCCN)NC(=O)C(CC(=O)N)NC(=O)C(CO)NC(=O)CNC(=O)C(C(C)C)NC(=O)C(CC(=O)O)NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CCC(=O)N)NC(=O)C(CC3=CN=CN3)NC(=O)C(CC4=CN=CN4)NC(=O)C(C(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CC5=CC=C(C=C5)O)NC(=O)CNC(=O)C(CO)NC(=O)C(CC(=O)O)NC(=O)C(CC6=CN=CN6)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC7=CC=CC=C7)NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)C(CC(=O)O)N |