2-Amino-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purine
2-Amino-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purine is a pharmaceutical compound used in the research of certain viral infections. With its antiviral properties, this compound has shown efficacy against various strains, including hepatitis B and herpes viruses. Its mechanism of action involves inhibiting viral replication, ultimately reducing viral load and symptoms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 690269-87-5 |
| Pricing | Inquire |
| Cas | 690269-87-5 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=CN=C(N=C32)N)CO)O)O |