(S)-SNAP 5114
(S)-SNAP 5114 is a GABA transport inhibitor, displaying selectivity for GAT-3 and GAT-2 (IC50 = 5, 21 and 388 μM for hGAT-3, rGAT-2 and hGAT-1, respectively). (S)-SNAP 5114 was shown to increase thalamic GABA levels, and acts as an anticonvulsant following systemic administration in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | 157604-55-2 |
| Pricing | Inquire |
| Cas | 157604-55-2 |
| Molecular Weight | 505.61 |
| Molecular Formula | C30H35NO6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)(C3=CC=C(C=C3)OC)OCCN4CCCC(C4)C(=O)O |