Bisphenol A(2,3-dihydroxypropyl)glycidyl ether
Bisphenol A(2,3-dihydroxypropyl)glycidyl ether (CAS# 76002-91-0) is an epoxide that is used as a starting substance in the manufacturing of can coatings for food-contact applications, pharmaceutial creams and may produce reaction products migration from the coating.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76002-91-0 |
| Pricing | Inquire |
| Cas | 76002-91-0 |
| Molecular Weight | 358.43 |
| Molecular Formula | C21H26O5 |
| Canonical SMILES | CC(C)(C1=CC=C(C=C1)OCC2CO2)C3=CC=C(C=C3)OCC(CO)O |