Ezetimibe Diacetate-[d4]
Ezetimibe Diacetate-[d4] is the labelled analogue of Ezetimibe Diacetate, which is a derivative of Ezetimibe. Ezetimibe is a medication used to treat high blood cholesterol and certain other lipid abnormalities. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L1) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005429 |
| Pricing | Inquire |
| Cas | 1217861-13-6 |
| Molecular Weight | 497.52 |
| Molecular Formula | C28H21D4F2NO5 |
| Canonical SMILES | CC(=O)OC1=CC=C(C=C1)C2C(C(=O)N2C3=CC=C(C=C3)F)CCC(C4=CC=C(C=C4)F)OC(=O)C |