rac N,O-Didesmethyl venlafaxine b-D-glucuronide
rac N,O-didesmethyl venlafaxine b-D-glucuronide is an acclaimed biomedical compound, serving as a tool for the study of depression and anxiety disorders. It is a discerning serotonin and norepinephrine reuptake inhibitor (SNRI).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1021933-99-2 |
| Pricing | Inquire |
| Cas | 1021933-99-2 |
| Molecular Weight | 425.47 |
| Molecular Formula | C21H31NO8 |
| Canonical SMILES | CNCC(C1=CC=C(C=C1)OC2C(C(C(C(O2)C(=O)O)O)O)O)C3(CCCCC3)O.Cl |