2-Amino-6-allylthio-9-(beta-D-ribofuranosyl)-9H-purine
2-Amino-6-allylthio-9-(beta-D-ribofuranosyl)-9H-purine is a highly effective antiviral compound widely employed in the field of biomedicine, holding potential in combating viral infections primarily induced by the notorious Herpes simplex virus (HSV) and Varicella-zoster virus (VZV). Significantly impeding viral DNA synthesis, replication, and protein biosynthesis, this remarkable compound facilitates in-depth investigation of innovative antiviral approaches and the advancement of therapeutic interventions targeting HSV and VZV-associated ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 92104-54-6 |
| Pricing | Inquire |
| Cas | 92104-54-6 |
| Molecular Weight | 339.37 |
| Molecular Formula | C13H17N5O4S |
| Canonical SMILES | C=CCSC1=NC(=NC2=C1N=CN2C3C(C(C(O3)CO)O)O)N |