Formoterol Fumarate Dihydrate EP Impurity I (R,S-isomer) ((R,S)-Formoterol)
Formoterol Fumarate Dihydrate EP Impurity I (R,S-isomer) ((R,S)-Formoterol) is an impurity of Formoterol Fumarate Dihydrate, a drug used for the therapy of various respiratory disorders, including asthma and chronic obstructive pulmonary disease (COPD).
| Supplier | BOC Sciences |
|---|---|
| Product # | 67346-51-4 |
| Pricing | Inquire |
| Cas | 67346-51-4 |
| Molecular Weight | 344.41 |
| Molecular Formula | C19H24N2O4 |
| Canonical SMILES | CC(CC1=CC=C(C=C1)OC)NCC(C2=CC(=C(C=C2)O)NC=O)O |