5-Deoxy-L-ribose phenylhydrazone
5-Deoxy-L-ribose phenylhydrazone, an intriguing compound, has been the subject of numerous biomedical research studies, aimed at elucidating its impact on cellular metabolism, specifically glucose transport and metabolism. Additionally, this multifaceted compound has ignited significant interest due to its potential to treat diverse maladies, including cancer, owing to its tumor growth-inhibiting properties and apoptosis-inducing abilities.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1999-001003 |
| Pricing | Inquire |
| Cas | 123168-30-9 |
| Molecular Weight | 224.26 |
| Molecular Formula | C11H16N2O3 |
| Canonical SMILES | CC(C(C(C=NNC1=CC=CC=C1)O)O)O |