PROTAC RAR Degrader-1
PROTAC RAR Degrader-1 comprises a cIAP1 ligand binding group, a linker and a RAR ligand binding group. PROTAC RAR Degrader-1 is an RAR degrader. Maximal RAR degradation at 30 μM concentration in HT1080 cells. Degradation inducers based on cIAP1 are called specific and non-genetic IAP-dependent protein erasers (SNIPERs).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1351169-27-1 |
| Pricing | Inquire |
| Cas | 1351169-27-1 |
| Molecular Weight | 917.14 |
| Molecular Formula | C51H72N4O11 |
| Canonical SMILES | O=C(O)C1=CC=C(C=CC(=O)C=2C=C(C=C(C2)C(C)(C)C)C(C)(C)C)C=C1OCCCNC(=O)COCCOCCOCCNC(=O)C(NC(=O)C(O)C(N)CC=3C=CC=CC3)CC(C)C |