Satratoxin H
Satratoxin H is a trichothecene mycotoxin that has been found in Stachybotrys. It induces production of reactive oxygen species (ROS), increases in malondialdehyde (MDA) levels, and induces apoptosis in PC12 cells when used at concentrations ranging from 5 to 100 nM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53126-64-0 |
| Pricing | Inquire |
| Cas | 53126-64-0 |
| Molecular Weight | 528.59 |
| Molecular Formula | C29H36O9 |
| Canonical SMILES | CC1=CC2C3(CC1)COC(=O)C=C4CCOC(C4O)(C=CC=CC(=O)OC5C3(C6(CO6)C(C5)O2)C)C(C)O |