5-O-(2-Amino-2-deoxy-D-glucopyranosyl) cytidine
5-O-(2-Amino-2-deoxy-D-glucopyranosyl) cytidine is an immensely valuable compound extensively utilized in the field of biomedical research, playing a pivotal role as a substrate for studying glycosylation reactions. In the quest for developing novel therapeutics targeting afflictions as profound as cancer, viral infections and genetic disorders, the application of this compound is indispensable.
| Supplier | BOC Sciences |
|---|---|
| Product # | 631842-23-4 |
| Pricing | Inquire |
| Cas | 631842-23-4 |
| Molecular Weight | 404.37 |
| Molecular Formula | C15H24N4O9 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)N)O)O |