1-Deoxy-3,4-O-isopropylidene-6-O-tert-butyldimethylsilyl-D-tagatose
1-Deoxy-3,4-O-isopropylidene-6-O-tert-butyldimethylsilyl-D-tagatose, an incredibly versatile compound, finds extensive utility in the biomedicine domain. Renowned for its indispensability, this product serves as a linchpin in the quest for groundbreaking pharmacotherapies addressing myriad ailments, such as diabetes and cancer. Its distinctive molecular configuration and intrinsic characteristics render it an optimal candidate for precision drug design and delivery, precisely targeting intricate cellular pathways and molecular entanglements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 942194-03-8 |
| Pricing | Inquire |
| Cas | 942194-03-8 |
| Molecular Weight | 318.49 |
| Molecular Formula | C15H30O5Si |
| Canonical SMILES | CC(=O)C1C(OC(O1)(C)C)C(CO[Si](C)(C)C(C)(C)C)O |