Cyanomethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside

Cyanomethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside is a versatile compound used in biomedicine. It acts as a substrate analog for β-galactosidase enzyme assays, aiding in the detection and quantification of this enzyme. Additionally, it can be employed for the synthesis of various drugs targeting diseases related to galactosyltransferase enzymes. This compound's unique structure and reactivity make it an essential tool in biomedical research and drug development.
Supplier BOC Sciences
Product # 61145-33-3
Pricing Inquire
Cas 61145-33-3
Molecular Weight 403.41
Molecular Formula C16H21NO9S
Canonical SMILES CC(=O)OCC1C(C(C(C(O1)SCC#N)OC(=O)C)OC(=O)C)OC(=O)C
Feedback