GnRH Associated Peptide (GAP) (1-13), human
GnRH Associated Peptide (GAP) (1-13), human is a potent inhibitor of prolactin secretion and stimulates the release of gonadotropins. Active immunization with peptides corresponding to the GAP sequences can significantly increase prolactin secretion.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100111-07-7 |
| Pricing | Inquire |
| Cas | 100111-07-7 |
| Molecular Weight | 1492.58 |
| Molecular Formula | C65H101N15O25 |
| Canonical SMILES | CCC(C)C(C(=O)NC(C(C)C)C(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CO)NC(=O)C(CC(=O)O)NC(=O)C(C(C)CC)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)N)NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)C(CC(=O)O)N |