2-C-Methyl-2,3-O-isopropylidene-D-lyxonic acid g-lactone
2-C-Methyl-2,3-O-isopropylidene-D-lyxonic acid g-lactone, a compound of utmost importance in the biomedical field, exhibits multifaceted functionality. Embodied within its molecular architecture lies the potential to engender an array of antiviral remedies, thus rendering it an irreplaceable entity within pharmaceutical investigations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 926659-25-8 |
| Pricing | Inquire |
| Cas | 926659-25-8 |
| Molecular Weight | 202.21 |
| Molecular Formula | C9H14O5 |
| Canonical SMILES | CC1(OC2C(OC(=O)C2(O1)C)CO)C |