rac-Duloxetine Hydrochloride (1:1 R:S Mixtures)
rac-Duloxetine Hydrochloride (1:1 R:S Mixtures) is the racemate of Duloxetine hydrochloride, which is a serotonin-norepinephrine reuptake inhibitor used to treat major depressive disorder, generalized anxiety disorder, fibromyalgia, neuropathic pain and central sensitization.
| Supplier | BOC Sciences |
|---|---|
| Product # | 947316-47-4 |
| Pricing | Inquire |
| Cas | 947316-47-4 |
| Molecular Weight | 333.87 |
| Molecular Formula | C18H20ClNOS |
| Canonical SMILES | CNCCC(C1=CC=CS1)OC2=CC=CC3=CC=CC=C32.Cl |