11-Dehydro Thromboxane B2-[d4]
11-Dehydro Thromboxane B2-[d4], is the labelled analogue of 11-Dehydro Thromboxane B2. 11-Dehydrothromboxane B2 is produced from the breakdown of thromboxane A2. It is released by activated platelets and urine levels of 11-dehydro-TXB2 can be used to monitor the response to aspirin therapy when used to prevent heart disease and in diseases where platelet activation is prominent.
Supplier | BOC Sciences |
---|---|
Product # | BLP-001779 |
Pricing | Inquire |
Cas | 1240398-15-5 |
Molecular Weight | 372.49 |
Molecular Formula | C20H28D4O6 |
Canonical SMILES | CCCCCC(C=CC1C(C(CC(=O)O1)O)CC=CCCCC(=O)O)O |