5-Bromo-3'-deoxy-3'-fluorouridine
5-Bromo-3'-deoxy-3'-fluorouridine is a remarkable compound, having research in triumphs over a range of RNA viruses, including retroviruses, herpesviruses and respiratory syncytial virus (RSV), unravelling an unrivalled breadth of antiviral efficacy. This compound exerts its remarkable effects by impeding viral RNA research and development through its unique structural features.
| Supplier | BOC Sciences |
|---|---|
| Product # | 439579-22-3 |
| Pricing | Inquire |
| Cas | 439579-22-3 |
| Molecular Weight | 325.09 |
| Molecular Formula | C9H16BrFN2O5 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)F)O)Br |