Benzyl N-acetyl-4,6-O-benzylidene-a-isomuramic acid
Benzyl N-acetyl-4,6-O-benzylidene-a-isomuramic acid, a paramount compound in the realm of biomedicine, unveils its immense potential in addressing bacterial infections. Its captivating antimicrobial qualities have sparked interest, rendering it a pivotal component in novel antibiotic formulations. Fueled by its inherent structure and properties, this entity emerges as a propitious contender to combat the menacing plight of drug-resistant bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 730911-70-3 |
| Pricing | Inquire |
| Cas | 730911-70-3 |
| Molecular Weight | 471.50 |
| Molecular Formula | C25H29NO8 |
| Canonical SMILES | CC(C(=O)O)OC1C(C(OC2C1OC(OC2)C3=CC=CC=C3)OCC4=CC=CC=C4)NC(=O)C |