Esmolol Acid HCl
Esmolol Acid HCl is an impurity of Esmolol. Esmolol is a cardioselective β-blocker which has a rapid onset but short duration of action without causing significant intrinsic sympathomimetic or membrane stabilizing activities at recommended therapeutic doses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83356-60-9 |
| Pricing | Inquire |
| Cas | 83356-60-9 |
| Molecular Weight | 317.81 |
| Molecular Formula | C15H23NO4.HCl |
| Canonical SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCC(=O)O)O.Cl |