1-Fluoro-4-nitrobenzene
1-Fluoro-4-nitrobenzene (CAS# 350-46-9) is an aryl fluorinated building block, and a common intermediate used for the synthesis of many industrial useful compounds. It is used for the preparation of novel soluble aromatic polyimides, such as 1,3,5-Tris(4-aminophenoxy)benzene (TAB) (T875005).
| Supplier | BOC Sciences |
|---|---|
| Product # | 350-46-9 |
| Pricing | Inquire |
| Cas | 350-46-9 |
| Molecular Weight | 141.10 |
| Molecular Formula | C6H4FNO2 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])F |