CO-1686 hydrobromide
CO-1686 hydrobromide is the hydrobromide salt form of CO-1686. CO-1686, also called as Rociletinib, is an oral tyrosine kinase inhibitor that irreversibly and selectively inhibits mutation of EGFR for treating Non-small cell lung cancer.Non-small cell lun
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-474582 |
| Pricing | Inquire |
| Cas | 1446700-26-0 |
| Molecular Weight | 636.46 |
| Molecular Formula | C27H29BrF3N7O3 |
| Canonical SMILES | CC(=O)N1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC(=CC=C4)NC(=O)C=C)C(F)(F)F)OC.Br |