Hydroxyterbinafine b-D-glucuronide
Hydroxyterbinafine b-D-glucuronide, a potent biomedical product originating from terbinafine, possesses remarkable antifungal properties indispensable for combating dermatophyte-induced fungal infections. Renowned for its metabolite status, this compound unveils an exceptional pharmacological profile, exuding heightened efficacy and therapeutic potency. Its unprecedented formulation, characterized by amplified bioavailability, serves as a pivotal catalyst in effectively managing afflictions like onychomycosis, tinea pedis, and tinea corporis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99473-12-8 |
| Pricing | Inquire |
| Cas | 99473-12-8 |
| Molecular Weight | 483.57 |
| Molecular Formula | C27H33NO7 |
| Canonical SMILES | CC(C)(COC1C(C(C(C(O1)C(=O)O)O)O)O)C#CC=CCN(C)CC2=CC=CC3=CC=CC=C32 |