Octyl 4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside
Octyl 4-O-(b-D-galactopyranosyl)-b-D-glucopyranoside, a compound of immense significance in the realm of biomedicine, epitomizes a potent scholarly asset. Its utilization predominates in an extensive array of pharmacological formulations, meticulously harnessed for the curative intervention of multifarious afflictions encompassing neoplastic pathology, metabolic derangements, and neurodegenerative pathologies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 74513-17-0 |
| Pricing | Inquire |
| Cas | 74513-17-0 |
| Molecular Weight | 454.51 |
| Molecular Formula | C20H38O11 |
| Canonical SMILES | CCCCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |