3'-O-DMTr-2'-O-Me-rU
3'-O-DMTr-2'-O-Me-rU is a modified ribonucleoside with a dimethoxytrityl (DMTr) group at the 3'-hydroxyl and a methyl group at the 2'-hydroxyl of the ribose moiety, based on uridine (rU). It is used in the chemical synthesis of RNA oligonucleotides, providing increased stability and protecting groups that facilitate efficient coupling reactions during oligonucleotide assembly, particularly in research and therapeutic RNA applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00707 |
| Pricing | Inquire |
| Cas | 801295-70-5 |
| Molecular Weight | 560.60 |
| Molecular Formula | C31H32N2O8 |
| Canonical SMILES | O=C1C=CN(C(=O)N1)C2OC(CO)C(OC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C2OC |