Acetyl-L-carnitine-[N,N-dimethyl-d6] hydrochloride
Acetyl-L-carnitine-[N,N-dimethyl-d6] hydrochloride is the deuterium labelled form of Acetyl-L-carnitine hydrochloride. Acetyl-L-carnitine hydrochloride is an acetic acid ester of L-carnitine that transports fatty acids into the mitochondria. It was demonstrated that exhibits antidepressant and neuroprotective activity, and it can upregulate metabotropic glutamate receptor 2 (mGlu2).
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-008467 |
| Pricing | Inquire |
| Molecular Weight | 245.73 |
| Molecular Formula | C9H12D6ClNO4 |
| Canonical SMILES | CC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |