L-779450
L-779450 is a potent, selective and ATP-competitive Raf kinase inhibitor (IC50 = 10 nM). L-779450 suppresses DNA synthesis and induces apoptosis in cells that proliferate in response to Raf-1 and A-Raf but not B-Raf.
| Supplier | BOC Sciences |
|---|---|
| Product # | 303727-31-3 |
| Pricing | Inquire |
| Cas | 303727-31-3 |
| Molecular Weight | 347.8 |
| Molecular Formula | C20H14ClN3O |
| Canonical SMILES | C1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC(=C(C=C4)Cl)O |