4-Methylumbelliferyl b-D-cellobioside
4-Methylumbelliferyl b-D-cellobioside, a molecular probe, serves as a critical substrate in Gaucher disease diagnosis through its utilization in enzymatic reaction studies amid rare genetic disorders caused by glucocerebrosidase deficiency. In the biomedical industry, it acts as a crucial experimental tool, enabling research into previously uncharted territories and expanding our understanding of enzymatic reactions as well as their disturbances.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72626-61-0 |
| Pricing | Inquire |
| Cas | 72626-61-0 |
| Molecular Weight | 500.45 |
| Molecular Formula | C22H28O13 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)CO)O)O)O)O)O |