5-Aza-dCTP
5-Aza-dCTP, a well-known nucleoside analogue is extensively employed in epigenetic and oncological surveys. Its mechanism of action encompasses subduing DNA methylation and augmenting DNA demethylation that instigates the revival of detained genes. Additionally, 5-Aza-dCTP is frequently administered in accompaniment with other therapeutic agents to tackle diverse malignancies such as leukemia and lung cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72052-96-1 |
| Pricing | Inquire |
| Cas | 72052-96-1 |
| Molecular Weight | 468.14 (free acid) |
| Molecular Formula | C8H15N4O13P3 (free acid) |
| Canonical SMILES | C1C(C(OC1N2C=NC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |