Janthinocin B
It is produced by the strain of Janthinobacterium lividum. Janthinocin B has strong activity of anti-gram-positive bacteria and moderate anti-gram-negative bacteria, and has strong inhibitory effect on drug-resistant staphylococcus such as penicillin, tetracycline, erythromycin, methicillin and gentamicin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01519 |
| Pricing | Inquire |
| Cas | 131086-53-8 |
| Molecular Weight | 1191.33 |
| Molecular Formula | C57H82N12O16 |
| Canonical SMILES | CCC(C)C(C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(=C(C2=CNC3=CC=CC=C32)O)NC(=O)C(NC(=O)C(=CC)NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)O)CO)C(C(C)C)O)CO)CCCN)CC4=CC=CC=C4)C(C)C)N |