Desoxycarbadox-[d3]
Desoxycarbadox-[d3] is the labelled analogue of Desoxycarbadox, which is a metabolite of Carbadox. Carbadox is a broad spectrum antibiotic commonly used as an in-feed additive for swine production to improve feed efficiency and to prevent dysentery and swine enteritis.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012935 |
| Pricing | Inquire |
| Cas | 1448350-02-4 |
| Molecular Weight | 233.24 |
| Molecular Formula | C11H7D3N4O2 |
| Canonical SMILES | COC(=O)NN=CC1=NC2=CC=CC=C2N=C1 |