Lucidenic acid C
Lucidenic acid C, an organic compound derived from the fungus Ganoderma lucidum, exhibits multifaceted pharmacological actions such as antioxidant, anti-inflammatory, immunomodulatory, and anticancer properties. Novel studies have elucidated that this naturally occurring triterpene exhibits profound inhibition of malignancy development and metastasis in cancer cells. The promising therapeutic potential of lucidenic acid C extends beyond oncology, offering a plethora of therapeutic applications in diverse pathological conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0005-465650 |
| Pricing | Inquire |
| Cas | 95311-96-9 |
| Molecular Weight | 476.6023 |
| Molecular Formula | C27H40O7 |
| Canonical SMILES | CC(CCC(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)O)C)C |