Benzamide, N-[9-[(1R)-2-(benzoyloxy)-1-[(1S)-2-[bis(4-methoxyphenyl)phenylmethoxy]-1-(hydroxymethyl)ethoxy]ethyl]-9H-purin-6-yl]-
Benzamide, N-[9-[(1R)-2-(benzoyloxy)-1-[(1S)-2-[bis(4-methoxyphenyl)phenylmethoxy]-1-(hydroxymethyl)ethoxy]ethyl]-9H-purin-6-yl]- is an extraordinary compound, exhibiting remarkable promise in studying a wide array of afflictions such as breast cancer and lung cancer. By effectively thwarting the uncontrolled proliferation of malignant cells, fostering apoptosis and inducing a drastic reduction in tumor magnitude, this remarkable compound proves its mettle.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1120329-51-2 |
| Pricing | Inquire |
| Cas | 1120329-51-2 |
| Molecular Weight | 779.84 |
| Molecular Formula | C45H41N5O8 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC(CO)OC(COC(=O)C4=CC=CC=C4)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |