4-[3-(Acryloyloxy)propoxy]benzoic acid
4-[3-(Acryloyloxy)propoxy]benzoic acid, an essential raw material in the synthesis of pharmaceuticals and agrochemicals, possesses enormous potential as a COX-2 inhibitor, thereby providing considerable therapeutic benefits in alleviating inflammation and pain. Moreover, it serves as an indispensable reagent in organic chemistry and is exclusively utilized in the synthesis of polymeric compounds and surface functionalization. Its multifaceted applications in various fields highlight its enormous industrial significance.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0001-103450 |
| Pricing | Inquire |
| Cas | 245349-46-6 |
| Molecular Weight | 250.25 |
| Molecular Formula | C13H14O5 |
| Canonical SMILES | C=CC(=O)OCCCOC1=CC=C(C=C1)C(=O)O |