Cyanine3.5 NHS ester
Cyanine3.5 NHS ester (an analog of Cy3.5® NHS ester) is a reactive dye for the labeling of amino-groups in peptides, proteins, and oligonucleotides.Cyanine3.5 NHS ester can replace NHS esters of Cy3.5®, Alexa Fluor 594, DyLight 594.
| Supplier | BOC Sciences |
|---|---|
| Product # | R01-0018 |
| Pricing | Inquire |
| Cas | 2231670-85-0 |
| Molecular Weight | 654.83 |
| Molecular Formula | C42H44N3O4 |
| Canonical SMILES | B(F)(F)F.CC1(C(=[N+](C2=C1C3=CC=CC=C3C=C2)C)C=CC=C4C(C5=C(N4CCCCCC(=O)ON6C(=O)CCC6=O)C=CC7=CC=CC=C75)(C)C)C.[F-] |