5'-O-(Dimethoxytrityl)-5,6-dihydro-2'-deoxyuridine
5'-O-(Dimethoxytrityl)-5,6-dihydro-2'-deoxyuridine is a vital compound acting as a precursor in the research and development of antiviral and antitumor drugs, specifically targeting DNA polymerases and nucleoside reverse transcriptase enzymes related to viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 869355-28-2 |
| Pricing | Inquire |
| Cas | 869355-28-2 |
| Molecular Weight | 530.57 |
| Molecular Formula | C30H30N2O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5CCC(=O)NC5=O)O |