2'-Deoxy-5'-O-DMT-N4-isobutyryl-5-methylcytidine
2'-Deoxy-5'-O-DMT-N4-isobutyryl-5-methylcytidine, a groundbreaking biomedical compound, holds immense significance in the advancement of focused therapeutics for diverse ailments. With its pivotal role in combating cancers, viral infections, and genetic disorders, this product intertwines with cutting-edge biomedical research. Its distinctive architecture and characteristics grant scientists an invaluable instrument to unravel innovative therapeutic modalities and enhance patient prognosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 176755-84-3 |
| Pricing | Inquire |
| Cas | 176755-84-3 |
| Molecular Weight | 613.71 |
| Molecular Formula | C35H39N3O7 |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C(C)C)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |