Saquayamycin B
It is produced by the strain of Str. nodosus MH190-16F3. It has antimicrobial effect, but it has weaker effect against gram-negative bacteria. It has inhibitory effect on leukemia P388 cells and adriamycin-resistant P388 cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02879 |
| Pricing | Inquire |
| Cas | 99260-67-0 |
| Molecular Weight | 820.83 |
| Molecular Formula | C43H48O16 |
| Canonical SMILES | CC1C(CCC(O1)OC2(CC(=O)C3(C4=C(C=CC3(C2)O)C(=O)C5=C(C4=O)C=CC(=C5O)C6CC7C(C(O6)C)OC8C(O7)CC(=O)C(O8)C)O)C)OC9C=CC(=O)C(O9)C |