(D-Glycero-α-D-manno-heptopyranosyl)-dihydogenphosphate, Cyclohexylammonium Salt
Key intermediate in the metabolism of sugars and their transformation to nucleotides. Also a potential inhibitor for the heptose synthetase, an enzyme of the biosynthesis of the inner core region of lipopolysaccharides. Contains 1-2 equivalents of cyclohexylamine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 359435-45-3 |
| Pricing | Inquire |
| Cas | 359435-45-3 |
| Molecular Weight | 389.34 |
| Molecular Formula | C13H28NO10P |
| Canonical SMILES | C1CCC(CC1)N.C(C(C1C(C(C(C(O1)OP(=O)(O)O)O)O)O)O)O |