2-Naphthyl b-D-mannopyranoside
2-Naphthyl b-D-mannopyranoside is a pivotal compound in the realm of compound, exhibiting a plethora of applications pertaining to the research and development of pharmaceutical remedies, primarily focused on ailments correlated with carbohydrate metabolism disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 212140-32-4 |
| Pricing | Inquire |
| Cas | 212140-32-4 |
| Molecular Weight | 306.31 |
| Molecular Formula | C16H18O6 |
| Canonical SMILES | C1=CC=C2C=C(C=CC2=C1)OC3C(C(C(C(O3)CO)O)O)O |