2',3'-Dideoxy-6-thio-inosine
2',3'-Dideoxy-6-thio-inosine, a powerful antiviral agent widely employed in the biomedical field, exhibits commendable efficacy against HIV, hepatitis B, and hepatitis C viral infections. Its mechanism of action involves impeding the replication of the virus via disruption of its genetic material. This pharmaceutical substance holds immense significance as a pivotal instrument in antiviral therapeutic interventions and scientific investigations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 126502-10-1 |
| Pricing | Inquire |
| Cas | 126502-10-1 |
| Molecular Weight | 252.29 |
| Molecular Formula | C10H12N4O2S |
| Canonical SMILES | C1CC(OC1CO)N2C=NC3=C2NC=NC3=S |