2-Isobutoxy-6-methoxyphenylboronic acid
2-Isobutoxy-6-methoxyphenylboronic acid is an extraordinary pharmaceutical compound that boasts remarkable therapeutic efficacy in the management of a multitude of ailments. Manifesting unparalleled affinities for distinct target proteins, this acid heralds a new era for the creation of bespoke medications. Scientific investigations vehemently advocate for its formidable anti-cancer, anti-inflammatory, and anti-diabetic capabilities.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1072951-97-3 |
| Pricing | Inquire |
| Cas | 1072951-97-3 |
| Molecular Weight | 224.1 |
| Molecular Formula | C11H17BO4 |
| Canonical SMILES | B(C1=C(C=CC=C1OCC(C)C)OC)(O)O |