4-O-(b-D-Glucopyranosyl)-D-pantothenic acid
4-O-(b-D-Glucopyranosyl)-D-pantothenic acid is an esteemed compound, applied predominantly in the pharmaceutical sector of afflictions, encompassing diabetes, cardiovascular disorders and neuronal dysfunctions. Its remarkable advantages reside in its adeptness to selectively modulate intricate cellular cascades and pathways that underlie the aforementioned maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 29493-59-2 |
| Pricing | Inquire |
| Cas | 29493-59-2 |
| Molecular Weight | 381.38 |
| Molecular Formula | C15H27NO10 |
| Canonical SMILES | CC(C)(COC1C(C(C(C(O1)CO)O)O)O)C(C(=O)NCCC(=O)O)O |