Methyl 3-(4-fluorobenzoyl)-6-methylpicolinate
Methyl 3-(4-fluorobenzoyl)-6-methylpicolinate is a biomedical product used in the research of various diseases. It acts as a potential inhibitor for the cancer research due to its ability to block specific proteins involved in tumor growth and progression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 461681-88-9 |
| Pricing | Inquire |
| Cas | 461681-88-9 |
| Molecular Weight | 273.26 |
| Molecular Formula | C15H12FNO3 |
| Canonical SMILES | CC1=NC(=C(C=C1)C(=O)C2=CC=C(C=C2)F)C(=O)OC |