Biphenyl-2-boronic acid
Reactant involved in:• Suzuki-Miyaura cross-coupling reactions with arylhalides, dibromovinyl precursors, alkenyl tosylates and mesylates, and quinoline carboxylates• Intramolecular Friedel-Crafts alkylation for synthesis of chiral tetralins• Hydroxylation to phenols• Oxidative coupling iwth alkynes
Substrate employed in a palladium-catalyzed cross-coupling with benzylic acetates providing diarylmethanes.
Substrate employed in a palladium-catalyzed cross-coupling with benzylic acetates providing diarylmethanes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4688-76-0 |
| Pricing | Inquire |
| Cas | 4688-76-0 |
| Molecular Weight | 198.02 |
| Molecular Formula | C12H11BO2 |
| Canonical SMILES | B(C1=CC=CC=C1C2=CC=CC=C2)(O)O |