Nifuroxazide-[d4]
Nifuroxazide-[d4] is the labelled analogue of Nifuroxazide. Nifuroxazide is a cell-permeable and orally available nitrofuran-based antidiarrheal agent that effectively suppresses the activation of cellular STAT1/3/5 transcription activity with IC50 of 3 μM against IL-6-induced STAT3 activation in U3A cells. It induces apoptosis in breast cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012479 |
| Pricing | Inquire |
| Cas | 1188487-83-3 |
| Molecular Weight | 279.24 |
| Molecular Formula | C12H5D4N3O5 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)NN=CC2=CC=C(O2)[N+](=O)[O-])O |