Kushenol C
Kushenol C is isolated from the root of Sophora flavescens and has anti-inflammatory and anti-oxidative stress effects. Kushenol C inhibits BACE1 (β-site APP cleaving enzyme 1) with an IC50 of 5.45 µM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99119-73-0 |
| Pricing | Inquire |
| Cas | 99119-73-0 |
| Molecular Weight | 438.47 |
| Molecular Formula | C25H26O7 |
| Canonical SMILES | CC(=CCC(CC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=C(C=C(C=C3)O)O)O)C(=C)C)C |